Products 61694-81-3

CAS 61694-81-3 is the registry number for FP802. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 50 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

N'-[(3-chlorophenyl)methyl]-N'-ethylethane-1,2-diamine (CAS 61694-81-3) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: N'-[(3-chlorophenyl)methyl]-N'-ethylethane-1,2-diamine. InChIKey: CEGPYWJJEVYOQS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN2
Molecular weight212.72 g/mol
IUPAC nameN'-[(3-chlorophenyl)methyl]-N'-ethylethane-1,2-diamine
InChIKeyCEGPYWJJEVYOQS-UHFFFAOYSA-N
SMILESCCN(CCN)CC1=CC(=CC=C1)Cl

Computed by PubChem (NCBI)