Products 617697-23-1
CAS 617697-23-1 is the registry number for N-(2,6-dimethylphenyl)-2-(2,3-dioxo-2,3-dihydro-1H-indol-1-yl)acetamide, ≥97%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg.
N-(2,6-dimethylphenyl)-2-(2,3-dioxoindol-1-yl)acetamide (CAS 617697-23-1) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-(2,3-dioxoindol-1-yl)acetamide. InChIKey: NILUPXUJWJAZQZ-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-(2,3-dioxoindol-1-yl)acetamide |
| InChIKey | NILUPXUJWJAZQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)