CAS 619-80-7 appears in our catalog under these names: 4-Nitrobenzamide, 96%, 4-Nitrobenzamide, >98.0%(N), 4-Nitrobenzamide, 4-NITROBENZAMIDE, 98%, 4-Nitrobenzamide, min. 95 %, 1 g. Offered by: Combi-blocks, TCI, Biosynth, Sigma-Aldrich, Roth. Available pack sizes: 25g, 5g, 1g, 100g, 500g, 2g, 1x1000mg.
4-nitrobenzamide (CAS 619-80-7) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 4-nitrobenzamide. InChIKey: ZESWUEBPRPGMTP-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4-nitrobenzamide |
| InChIKey | ZESWUEBPRPGMTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)