Products 6190-46-1
CAS 6190-46-1 appears in our catalog under these names: Methyl (2E,4E)-5-(benzo[d][1,3]dioxol-5-yl)penta-2,4-dienoate, ≥98%, ≥98%, Methyl piperate. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 1 mg, 10 mg, 5 mg.
Methyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate (CAS 6190-46-1) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: methyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate. InChIKey: VOZJBFJHMHRLDN-ZUVMSYQZSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | methyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
| InChIKey | VOZJBFJHMHRLDN-ZUVMSYQZSA-N |
| SMILES | COC(=O)/C=C/C=C/C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)
Synonyms:
Methyl piperate, Piperinic acid methyl ester, Piperic acid methyl ester, (2E,4E)-methyl 5-(benzo[d][1,3]dioxol-5-yl)penta-2,4-dienoate, methyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate, 2,4-Pentadienoic acid, 5-(1,3-benzodioxol-5-yl)-, methyl ester, (2E,4E)-, 2,4-Pentadienoic acid, 5-(1,3-benzodioxol-5-yl)-, methyl ester, (E,E)-, (2E,4E)-methyl 5-(benzo(d)(1,3)dioxol-5-yl)penta-2,4-dienoate, Methyl piperic acid, VOZJBFJHMHRLDN-ZUVMSYQZSA-N