CAS 62000-10-6 is the registry number for (((2-Nitro-1,3-phenylene)bis(oxy))bis(methylene))dibenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-nitro-1,3-bis(phenylmethoxy)benzene (CAS 62000-10-6) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 2-nitro-1,3-bis(phenylmethoxy)benzene. InChIKey: AXXIQEWXEWOVLS-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-nitro-1,3-bis(phenylmethoxy)benzene |
| InChIKey | AXXIQEWXEWOVLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC=C2)OCC3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)