CAS 621-06-7 appears in our catalog under these names: N,2-Diphenylacetamide, >98.0%(HPLC)(T), N,2-Diphenylacetamide 98%, N,2-Diphenylacetamide, 98%, 98%, N,2-Diphenylacetamide, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
N,2-diphenylacetamide (CAS 621-06-7) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: N,2-diphenylacetamide. InChIKey: KYPIASPTMDEDQB-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | N,2-diphenylacetamide |
| InChIKey | KYPIASPTMDEDQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)