Products 62124-43-0
CAS 62124-43-0 appears in our catalog under these names: 2-Chloro-5-phenyloxazole, 98%, 2-Chloro-5-phenyloxazole, 2-Chloro-5-phenyloxazole 97%, 2-Chloro-5-phenyloxazole, 98%, 98%, 2-Chloro-5-phenyloxazole, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg, 10g, 25g.
2-chloro-5-phenyl-1,3-oxazole (CAS 62124-43-0) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 2-chloro-5-phenyl-1,3-oxazole. InChIKey: RQAIEHDXUZPMBJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 2-chloro-5-phenyl-1,3-oxazole |
| InChIKey | RQAIEHDXUZPMBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)Cl |
Computed by PubChem (NCBI)