CAS 6220-15-1 appears in our catalog under these names: 1–Hexylpyridin–1–ium chloride, 1-Hexylpyridin-1-ium chloride, 97%, 1-Hexylpyridin-1-ium chloride, 99%, 1-Hexylpyridin-1-Ium Chloride, 99%, 99%, 1-Hexylpyridinium Chloride. Offered by: GLPBio, AmBeed, Fluorochem, Chemat, Chemat Brand. Available pack sizes: 25g, 5g, 1g, 100g, 10g, on request.
1-hexylpyridin-1-ium chloride (CAS 6220-15-1) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 1-hexylpyridin-1-ium chloride. InChIKey: JEOSMYVMLZTQOH-UHFFFAOYSA-M.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 1-hexylpyridin-1-ium chloride |
| InChIKey | JEOSMYVMLZTQOH-UHFFFAOYSA-M |
| SMILES | CCCCCC[N+]1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)