CAS 6253-19-6 is the registry number for Norharmine. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methoxy-9H-pyrido[3,4-b]indole (CAS 6253-19-6) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 7-methoxy-9H-pyrido[3,4-b]indole. InChIKey: LMDPJJFWLNRVEH-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 7-methoxy-9H-pyrido[3,4-b]indole |
| InChIKey | LMDPJJFWLNRVEH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(N2)C=NC=C3 |
Computed by PubChem (NCBI)