CAS 62536-94-1 is the registry number for 4-(Benzyloxy)-N'-hydroxybenzene-1-carboximidamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
N'-hydroxy-4-phenylmethoxybenzenecarboximidamide (CAS 62536-94-1) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: N'-hydroxy-4-phenylmethoxybenzenecarboximidamide. InChIKey: QBOOJKVECPVATQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | N'-hydroxy-4-phenylmethoxybenzenecarboximidamide |
| InChIKey | QBOOJKVECPVATQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=NO)N |
Computed by PubChem (NCBI)