Products 62577-95-1
CAS 62577-95-1 appears in our catalog under these names: 4-Cyclobutoxybenzoic acid, 97%, 4-Cyclobutoxybenzoic acid, 4-Cyclobutoxybenzoic acid 97%, 4-Cyclobutoxybenzoic acid, 97%, 97%, 4-(Cyclobutyloxy)benzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
4-cyclobutyloxybenzoic acid (CAS 62577-95-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 4-cyclobutyloxybenzoic acid. InChIKey: SBJGJSIFGXOICD-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 4-cyclobutyloxybenzoic acid |
| InChIKey | SBJGJSIFGXOICD-UHFFFAOYSA-N |
| SMILES | C1CC(C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)