CAS 6268-23-1 is the registry number for Propan-2-yl 3-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Propan-2-yl 3-nitrobenzoate (CAS 6268-23-1) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: propan-2-yl 3-nitrobenzoate. InChIKey: ICDANRFRDBFMRY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | propan-2-yl 3-nitrobenzoate |
| InChIKey | ICDANRFRDBFMRY-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)