Products 62706-43-8
CAS 62706-43-8 is the registry number for Maturin. Offered by: Chemat Brand. Available pack sizes: on request.
3-(hydroxymethyl)-9-methoxy-5-methylbenzo[f][1]benzofuran-4-carbaldehyde (CAS 62706-43-8) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 3-(hydroxymethyl)-9-methoxy-5-methylbenzo[f][1]benzofuran-4-carbaldehyde. InChIKey: GGLXDYDRZKRTDI-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3-(hydroxymethyl)-9-methoxy-5-methylbenzo[f][1]benzofuran-4-carbaldehyde |
| InChIKey | GGLXDYDRZKRTDI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C3C(=C2C=O)C(=CO3)CO)OC |
Computed by PubChem (NCBI)