Products 627887-48-3

CAS 627887-48-3 appears in our catalog under these names: 2-Methylmorpholine-4-sulfonyl chloride, 95%, 2-Methylmorpholine-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2-methylmorpholine-4-sulfonyl chloride (CAS 627887-48-3) is a chemical compound with the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. IUPAC name: 2-methylmorpholine-4-sulfonyl chloride. InChIKey: FYKOGVZTHAJLMB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10ClNO3S
Molecular weight199.66 g/mol
IUPAC name2-methylmorpholine-4-sulfonyl chloride
InChIKeyFYKOGVZTHAJLMB-UHFFFAOYSA-N
SMILESCC1CN(CCO1)S(=O)(=O)Cl

Computed by PubChem (NCBI)