CAS 66185-37-3 appears in our catalog under these names: (R)-3-(Acetylthio)-2-aminopropanoic acid hydrochloride, S-Acetyl-L-Cysteine HCl. Offered by: Biosynth, Chemat Brand. Available pack sizes: 0,1g, on request.
(2R)-3-acetylsulfanyl-2-aminopropanoic acid;hydrochloride (CAS 66185-37-3) is a chemical compound with the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. IUPAC name: (2R)-3-acetylsulfanyl-2-aminopropanoic acid;hydrochloride. InChIKey: DQFRVPNDUNPMLI-WCCKRBBISA-N.
| Molecular formula | C5H10ClNO3S |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | (2R)-3-acetylsulfanyl-2-aminopropanoic acid;hydrochloride |
| InChIKey | DQFRVPNDUNPMLI-WCCKRBBISA-N |
| SMILES | CC(=O)SC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)