Products 1446526-77-7

CAS 1446526-77-7 is the registry number for 4-Hydroxypiperidine-1-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-hydroxypiperidine-1-sulfonyl chloride (CAS 1446526-77-7) is a chemical compound with the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. IUPAC name: 4-hydroxypiperidine-1-sulfonyl chloride. InChIKey: XLPIAGMFZFFEJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10ClNO3S
Molecular weight199.66 g/mol
IUPAC name4-hydroxypiperidine-1-sulfonyl chloride
InChIKeyXLPIAGMFZFFEJQ-UHFFFAOYSA-N
SMILESC1CN(CCC1O)S(=O)(=O)Cl

Computed by PubChem (NCBI)