CAS 2922060-79-3 is the registry number for 4-Oxo-L-methionine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2S)-2-amino-4-methylsulfanyl-4-oxobutanoic acid;hydrochloride (CAS 2922060-79-3) is a chemical compound with the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. IUPAC name: (2S)-2-amino-4-methylsulfanyl-4-oxobutanoic acid;hydrochloride. InChIKey: WASQLPSZYMXCBU-DFWYDOINSA-N.
| Molecular formula | C5H10ClNO3S |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | (2S)-2-amino-4-methylsulfanyl-4-oxobutanoic acid;hydrochloride |
| InChIKey | WASQLPSZYMXCBU-DFWYDOINSA-N |
| SMILES | CSC(=O)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)