Products 1601248-25-2
CAS 1601248-25-2 is the registry number for 1-(Dimethylcarbamoyl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(dimethylamino)-1-oxopropane-2-sulfonyl chloride (CAS 1601248-25-2) is a chemical compound with the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. IUPAC name: 1-(dimethylamino)-1-oxopropane-2-sulfonyl chloride. InChIKey: QBHOJSGSVGKIPZ-UHFFFAOYSA-N.
| Molecular formula | C5H10ClNO3S |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 1-(dimethylamino)-1-oxopropane-2-sulfonyl chloride |
| InChIKey | QBHOJSGSVGKIPZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)