Products 1200798-09-9

CAS 1200798-09-9 appears in our catalog under these names: 1,4-Oxazepane-4-sulfonyl chloride, 95%, 1,4-Oxazepane-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

1,4-oxazepane-4-sulfonyl chloride (CAS 1200798-09-9) is a chemical compound with the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. IUPAC name: 1,4-oxazepane-4-sulfonyl chloride. InChIKey: DXKIPKJKQNQXOU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10ClNO3S
Molecular weight199.66 g/mol
IUPAC name1,4-oxazepane-4-sulfonyl chloride
InChIKeyDXKIPKJKQNQXOU-UHFFFAOYSA-N
SMILESC1CN(CCOC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)