CAS 62810-39-3 appears in our catalog under these names: 4’-Chloro-3-hydroxy-benzophenone, 4-Chloro-3-hydroxy-benzophenone. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 25mg, 100mg, 250mg.
(4-chlorophenyl)-(3-hydroxyphenyl)methanone (CAS 62810-39-3) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: (4-chlorophenyl)-(3-hydroxyphenyl)methanone. InChIKey: WBQUCIOFUOIVNX-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | (4-chlorophenyl)-(3-hydroxyphenyl)methanone |
| InChIKey | WBQUCIOFUOIVNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)