CAS 62825-88-1 is the registry number for 5-((2-Chlorophenyl)methyl)-1,3-oxazolidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one (CAS 62825-88-1) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one. InChIKey: PCOMYIUSMUMECB-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one |
| InChIKey | PCOMYIUSMUMECB-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1)CC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)