CAS 62848-47-9 is the registry number for (2,5-Dioxo-1-phenyl-imidazolidin-4-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2,5-dioxo-1-phenylimidazolidin-4-yl)acetic acid (CAS 62848-47-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 2-(2,5-dioxo-1-phenylimidazolidin-4-yl)acetic acid. InChIKey: YITSTEXIMAEZDR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-(2,5-dioxo-1-phenylimidazolidin-4-yl)acetic acid |
| InChIKey | YITSTEXIMAEZDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(NC2=O)CC(=O)O |
Computed by PubChem (NCBI)