Products 62848-47-9

CAS 62848-47-9 is the registry number for (2,5-Dioxo-1-phenyl-imidazolidin-4-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,5-dioxo-1-phenylimidazolidin-4-yl)acetic acid (CAS 62848-47-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 2-(2,5-dioxo-1-phenylimidazolidin-4-yl)acetic acid. InChIKey: YITSTEXIMAEZDR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O4
Molecular weight234.21 g/mol
IUPAC name2-(2,5-dioxo-1-phenylimidazolidin-4-yl)acetic acid
InChIKeyYITSTEXIMAEZDR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=O)C(NC2=O)CC(=O)O

Computed by PubChem (NCBI)