CAS 62881-98-5 is the registry number for 2-(2-Chlorophenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
2-(2-chlorophenyl)-1,3-oxazole (CAS 62881-98-5) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-oxazole. InChIKey: IWUACMRENZNWBB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-oxazole |
| InChIKey | IWUACMRENZNWBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=CO2)Cl |
Computed by PubChem (NCBI)