Products 6297-10-5
CAS 6297-10-5 appears in our catalog under these names: Ethyl 6-Methoxy-2-naphthoate, Ethyl 6-methoxy-2-naphthoate, 97%. Offered by: TRC, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
Ethyl 6-methoxynaphthalene-2-carboxylate (CAS 6297-10-5) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: ethyl 6-methoxynaphthalene-2-carboxylate. InChIKey: VSRGZETWBNHFSB-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | ethyl 6-methoxynaphthalene-2-carboxylate |
| InChIKey | VSRGZETWBNHFSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)