CAS 62971-64-6 appears in our catalog under these names: 3,4-Dimethyl-5-sulfamoylbenzoic acid, 95%, 3,4-Dimethyl-5-sulfamoylbenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
3,4-dimethyl-5-sulfamoylbenzoic acid (CAS 62971-64-6) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 3,4-dimethyl-5-sulfamoylbenzoic acid. InChIKey: XPJVOWIAQQEUFK-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 3,4-dimethyl-5-sulfamoylbenzoic acid |
| InChIKey | XPJVOWIAQQEUFK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)