CAS 62985-52-8 is the registry number for 4'-Carboethoxy-2,2-dimethylpropiophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 4-(2,2-dimethylpropanoyl)benzoate (CAS 62985-52-8) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: ethyl 4-(2,2-dimethylpropanoyl)benzoate. InChIKey: POIFTPVXUWQHRA-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | ethyl 4-(2,2-dimethylpropanoyl)benzoate |
| InChIKey | POIFTPVXUWQHRA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)