CAS 63136-62-9 appears in our catalog under these names: 4-chloro-2,3-dimethylquinoline, 98%, 4-Chloro-2,3-dimethylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g, 50mg.
4-chloro-2,3-dimethylquinoline (CAS 63136-62-9) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-2,3-dimethylquinoline. InChIKey: KQXLLCFFOGCXJH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-2,3-dimethylquinoline |
| InChIKey | KQXLLCFFOGCXJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N=C1C)Cl |
Computed by PubChem (NCBI)