CAS 63235-39-2 appears in our catalog under these names: 8-Hydroxy-5-(2-((1-methylethyl)amino)-1-oxobutyl)-2(1H)-quinolinone, Procaterol Impurity 5, Procaterol Impurity 7, Promethazine Impurity 8. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, 1mg, 5mg, on request.
8-hydroxy-5-[2-(propan-2-ylamino)butanoyl]-1H-quinolin-2-one (CAS 63235-39-2) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: 8-hydroxy-5-[2-(propan-2-ylamino)butanoyl]-1H-quinolin-2-one. InChIKey: LCMWSWALJPFSEA-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O3 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 8-hydroxy-5-[2-(propan-2-ylamino)butanoyl]-1H-quinolin-2-one |
| InChIKey | LCMWSWALJPFSEA-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=C2C=CC(=O)NC2=C(C=C1)O)NC(C)C |
Computed by PubChem (NCBI)