CAS 63352-97-6 appears in our catalog under these names: 2-(7-bromo-1H-indol-3-yl)acetic acid, 97%, 97%, 2-(7-Bromo-1h-indol-3-yl)acetic acid, 95%, 2–(7–Bromo–1H–indol–3–yl)acetic acid, 2-(7-Bromo-1H-indol-3-yl)acetic acid, 98%. Offered by: Chemat, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
2-(7-bromo-1H-indol-3-yl)acetic acid (CAS 63352-97-6) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(7-bromo-1H-indol-3-yl)acetic acid. InChIKey: XYQBUBGQOKPXBN-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(7-bromo-1H-indol-3-yl)acetic acid |
| InChIKey | XYQBUBGQOKPXBN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C2CC(=O)O |
Computed by PubChem (NCBI)