CAS 63381-38-4 appears in our catalog under these names: 1-(3-Hydroxyphenyl)-2,5-dihydro-1h-pyrrole-2,5-dione, 95%, N-(3-Hydroxyphenyl)maleimide. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 1g, 200mg, 25mg, 50mg, 2g, 5g, 25g.
1-(3-hydroxyphenyl)pyrrole-2,5-dione (CAS 63381-38-4) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 1-(3-hydroxyphenyl)pyrrole-2,5-dione. InChIKey: YWODHBPFOGXUFX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)pyrrole-2,5-dione |
| InChIKey | YWODHBPFOGXUFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)