CAS 6343-81-3 is the registry number for 2-(2-Hydroxyethyl)-1,2-benzisothiazol-3(2H)-one 1,1-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one (CAS 6343-81-3) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: CJWAPCSQEWUZAE-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | CJWAPCSQEWUZAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)CCO |
Computed by PubChem (NCBI)