Products 6343-81-3

CAS 6343-81-3 is the registry number for 2-(2-Hydroxyethyl)-1,2-benzisothiazol-3(2H)-one 1,1-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one (CAS 6343-81-3) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: CJWAPCSQEWUZAE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO4S
Molecular weight227.24 g/mol
IUPAC name2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one
InChIKeyCJWAPCSQEWUZAE-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(S2(=O)=O)CCO

Computed by PubChem (NCBI)