Products 63565-07-1
CAS 63565-07-1 appears in our catalog under these names: 8–Benzoyl–5，7–dihydroxy–2，2–dimethylchromane, 8-Benzoyl-5,7-dihydroxy-2,2-dimethylchromane. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(5,7-dihydroxy-2,2-dimethyl-3,4-dihydrochromen-8-yl)-phenylmethanone (CAS 63565-07-1) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: (5,7-dihydroxy-2,2-dimethyl-3,4-dihydrochromen-8-yl)-phenylmethanone. InChIKey: QEIRIDQYHRTGBH-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | (5,7-dihydroxy-2,2-dimethyl-3,4-dihydrochromen-8-yl)-phenylmethanone |
| InChIKey | QEIRIDQYHRTGBH-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C(=C(C=C2O)O)C(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)