CAS 63725-54-2 is the registry number for 6-Chloro-2,4-dimethyl-2H-pyrazolo(3,4-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-2,4-dimethylpyrazolo[3,4-b]pyridine (CAS 63725-54-2) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 6-chloro-2,4-dimethylpyrazolo[3,4-b]pyridine. InChIKey: PKWZMAALBFVDLC-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 6-chloro-2,4-dimethylpyrazolo[3,4-b]pyridine |
| InChIKey | PKWZMAALBFVDLC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NN(C=C12)C)Cl |
Computed by PubChem (NCBI)