Products 63744-22-9
CAS 63744-22-9 appears in our catalog under these names: 6,8–Dibromoimidazo(1,2–a)pyrazine, 6,8-Dibromoimidazo¬1,2-a|pyrazine, 95% , 6,8-Dibromoimidazo[1,2-a]pyrazine, >98.0%(GC), 6,8-Dibromoimidazo[1,2-a]pyrazine 97%, 6,8-Dibromoimidazo[1,2-a]pyrazine, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 1kg.
6,8-dibromoimidazo[1,2-a]pyrazine (CAS 63744-22-9) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 6,8-dibromoimidazo[1,2-a]pyrazine. InChIKey: UQCZZGIPIMJBCL-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 6,8-dibromoimidazo[1,2-a]pyrazine |
| InChIKey | UQCZZGIPIMJBCL-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C(C2=N1)Br)Br |
Computed by PubChem (NCBI)