CAS 63770-51-4 is the registry number for 3,6-Dimethyl-5-nitrobenzo[d]isoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dimethyl-5-nitro-1,2-benzoxazole (CAS 63770-51-4) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 3,6-dimethyl-5-nitro-1,2-benzoxazole. InChIKey: PRFLEULYCUOJCH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3,6-dimethyl-5-nitro-1,2-benzoxazole |
| InChIKey | PRFLEULYCUOJCH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1[N+](=O)[O-])C(=NO2)C |
Computed by PubChem (NCBI)