CAS 63833-47-6 is the registry number for (4–nitrophenyl)(1H–pyrrol–2–yl)methanone. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(4-nitrophenyl)-(1H-pyrrol-2-yl)methanone (CAS 63833-47-6) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: (4-nitrophenyl)-(1H-pyrrol-2-yl)methanone. InChIKey: OLBZXLMVXOLTRU-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | (4-nitrophenyl)-(1H-pyrrol-2-yl)methanone |
| InChIKey | OLBZXLMVXOLTRU-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)