CAS 63897-12-1 appears in our catalog under these names: 2,4-Dichloro-6-methyl-3-nitropyridine 98%, 2,4-Dichloro-6-methyl-3-nitropyridine, 98%, 98%, 2,4-Dichloro-6-methyl-3-nitropyridine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 250g, 50g.
2,4-dichloro-6-methyl-3-nitropyridine (CAS 63897-12-1) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,4-dichloro-6-methyl-3-nitropyridine. InChIKey: MTGIKTMXZFIZLS-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,4-dichloro-6-methyl-3-nitropyridine |
| InChIKey | MTGIKTMXZFIZLS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)