CAS 63927-23-1 appears in our catalog under these names: 5-Bromo-8-nitroisoquinoline, >98.0%(GC)(T), 5-Bromo-8-nitroisoquinoline 97%, 5-Bromo-8-nitroisoquinoline, 95%. Offered by: TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
5-bromo-8-nitroisoquinoline (CAS 63927-23-1) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 5-bromo-8-nitroisoquinoline. InChIKey: ULGOLOXWHJEZNZ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 5-bromo-8-nitroisoquinoline |
| InChIKey | ULGOLOXWHJEZNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CN=CC2=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)