CAS 639857-68-4 is the registry number for Pranoprofen Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
7-ethyl-5H-chromeno[2,3-b]pyridine (CAS 639857-68-4) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 7-ethyl-5H-chromeno[2,3-b]pyridine. InChIKey: UFGINEUJLMPANF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 7-ethyl-5H-chromeno[2,3-b]pyridine |
| InChIKey | UFGINEUJLMPANF-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC3=C(C2)C=CC=N3 |
Computed by PubChem (NCBI)