CAS 639863-89-1 appears in our catalog under these names: 2–(4–(4H–1,2,4–Triazol–4–yl)phenyl)aceticacid, 2-(4-(4H-1,2,4-Triazol-4-yl)phenyl)acetic acid, 2-[4-(4H-1,2,4-TRIAZOL-4-YL)PHENYL]ACETIC ACID, 98%, 98%, 2-[4-(4H-1,2,4-TRIAZOL-4-YL)PHENYL]ACETIC ACID, 98%, 2-(4-(4H-1,2,4-Triazol-4-yl)phenyl)acetic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 0,5g, 100mg, 25g.
2-[4-(1,2,4-triazol-4-yl)phenyl]acetic acid (CAS 639863-89-1) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 2-[4-(1,2,4-triazol-4-yl)phenyl]acetic acid. InChIKey: FDMDQFRWRSOCPC-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2-[4-(1,2,4-triazol-4-yl)phenyl]acetic acid |
| InChIKey | FDMDQFRWRSOCPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)N2C=NN=C2 |
Computed by PubChem (NCBI)