CAS 63987-19-9 appears in our catalog under these names: 4'-Hydroxy-3-phenoxybenzyl Alcohol, 4-(3-(Hydroxymethyl)phenoxy)phenol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg.
4-[3-(hydroxymethyl)phenoxy]phenol (CAS 63987-19-9) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 4-[3-(hydroxymethyl)phenoxy]phenol. InChIKey: PJOAGCNCAOJNKZ-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 4-[3-(hydroxymethyl)phenoxy]phenol |
| InChIKey | PJOAGCNCAOJNKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)O)CO |
Computed by PubChem (NCBI)