CAS 640767-43-7 is the registry number for Vortioxetine Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-5-(2-nitrophenyl)sulfanylbenzene (CAS 640767-43-7) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 1,3-dimethyl-5-(2-nitrophenyl)sulfanylbenzene. InChIKey: SHVLCPJNYISMAT-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 1,3-dimethyl-5-(2-nitrophenyl)sulfanylbenzene |
| InChIKey | SHVLCPJNYISMAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)SC2=CC=CC=C2[N+](=O)[O-])C |
Computed by PubChem (NCBI)