CAS 641617-45-0 appears in our catalog under these names: 6-Bromo-1-methyl-1H-imidazo(4,5-b)pyridin-2-amine, 98%, 6-Bromo-1-methyl-1H-imidazo[4,5-b]pyridin-2-amine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
6-bromo-1-methylimidazo[4,5-b]pyridin-2-amine (CAS 641617-45-0) is a chemical compound with the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. IUPAC name: 6-bromo-1-methylimidazo[4,5-b]pyridin-2-amine. InChIKey: UIGQFOXIYBGMHG-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4 |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 6-bromo-1-methylimidazo[4,5-b]pyridin-2-amine |
| InChIKey | UIGQFOXIYBGMHG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=CC(=C2)Br)N=C1N |
Computed by PubChem (NCBI)