CAS 64163-09-3 is the registry number for 2,5-Dichloro-3-phenylpyrazine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2,5-dichloro-3-phenylpyrazine (CAS 64163-09-3) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,5-dichloro-3-phenylpyrazine. InChIKey: UVHFTHLANSFULO-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,5-dichloro-3-phenylpyrazine |
| InChIKey | UVHFTHLANSFULO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CN=C2Cl)Cl |
Computed by PubChem (NCBI)