Products 64170-83-8
CAS 64170-83-8 is the registry number for 4,4′-(1-Methylethylidene)bis[2-methoxyphenol], 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4-[2-(4-hydroxy-3-methoxyphenyl)propan-2-yl]-2-methoxyphenol (CAS 64170-83-8) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 4-[2-(4-hydroxy-3-methoxyphenyl)propan-2-yl]-2-methoxyphenol. InChIKey: QZXMNADTEUPJOV-UHFFFAOYSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 4-[2-(4-hydroxy-3-methoxyphenyl)propan-2-yl]-2-methoxyphenol |
| InChIKey | QZXMNADTEUPJOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)O)OC)C2=CC(=C(C=C2)O)OC |
Computed by PubChem (NCBI)