Products 64193-00-6
CAS 64193-00-6 appears in our catalog under these names: DL-3-Phenylalanine-13C-2, DL-Phenylalanine-1-13C 13C 99atom %. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: Get quote, 500MG.
2-amino-3-phenyl(113C)propanoic acid (CAS 64193-00-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-amino-3-phenyl(113C)propanoic acid. InChIKey: COLNVLDHVKWLRT-QBZHADDCSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-amino-3-phenyl(113C)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-QBZHADDCSA-N |
| SMILES | C1=CC=C(C=C1)CC([13C](=O)O)N |
Computed by PubChem (NCBI)