Products 64193-01-7
CAS 64193-01-7 appears in our catalog under these names: DL-Phenylalanine-2-13C, 99 atom % 13C, min 98% Chemical Purity, DL–3–Phenylalanine–13C–1, DL-3-Phenylalanine-13C-1, ≥99 atom% 13C,≥97%, ≥99 atom% 13C,≥97%, DL-3-Phenylalanine-13C-1, 98.03%. Offered by: CDN, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,5g, 10mg, 100mg, 5mg, 50mg, 100 mg, 5 mg, 50 mg.
2-amino-3-phenyl(213C)propanoic acid (CAS 64193-01-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-amino-3-phenyl(213C)propanoic acid. InChIKey: COLNVLDHVKWLRT-VJJZLTLGSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-amino-3-phenyl(213C)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-VJJZLTLGSA-N |
| SMILES | C1=CC=C(C=C1)C[13CH](C(=O)O)N |
Computed by PubChem (NCBI)