CAS 642459-03-8 appears in our catalog under these names: 6-Chloro-n-phenylpyrazin-2-amine, 95%, 6–Chloro–N–phenylpyrazin–2–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
6-chloro-N-phenylpyrazin-2-amine (CAS 642459-03-8) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 6-chloro-N-phenylpyrazin-2-amine. InChIKey: IMACCNVRJOXLEO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 6-chloro-N-phenylpyrazin-2-amine |
| InChIKey | IMACCNVRJOXLEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)