CAS 64468-77-5 is the registry number for 4-Furan-2-yl-benzonitrile, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 2g.
4-(furan-2-yl)benzonitrile (CAS 64468-77-5) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 4-(furan-2-yl)benzonitrile. InChIKey: ZCUXWFVAKYORDX-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 4-(furan-2-yl)benzonitrile |
| InChIKey | ZCUXWFVAKYORDX-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)