Products 6451-85-0

CAS 6451-85-0 is the registry number for 3-Hydroxy-1-indazolecarboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-oxo-2H-indazole-1-carboxylate (CAS 6451-85-0) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: ethyl 3-oxo-2H-indazole-1-carboxylate. InChIKey: RFZCKRFBTMJGTK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O3
Molecular weight206.20 g/mol
IUPAC nameethyl 3-oxo-2H-indazole-1-carboxylate
InChIKeyRFZCKRFBTMJGTK-UHFFFAOYSA-N
SMILESCCOC(=O)N1C2=CC=CC=C2C(=O)N1

Computed by PubChem (NCBI)